Benzyldimethyltetradecylammonium chloride, anhydrous, ≥99%

BI-0005

139-08-2

for biochemistry

CH3(CH2)13N(Cl)(CH3)2CH2C6H5

2942

99%

404.07

Bottle / Drum

18%

Benzyldimethyltetradecylammonium chloride (BTDACl), a quaternary ammonium compound, is a cationic surfactant.

BI-0005 (OTTO) Benzyldimethyltetradecylammonium chloride, anhydrous, ≥99% Cas 139-08-2 - used in the following studies spectrophotometric determination of cobalt(II).

PackingsPrice (INR)
10 gm 4707.00
100 gm POR
PackingsPrice (INR)
10 gm 4707.00
100 gm POR

Enquiry